C19H21NO6 — CID 102507389
methyl (E)-3-[2,5-bis(2-ethenoxyethoxy)phenyl]-2-cyanoprop-2-enoate (PubChem CID 102507389) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is methyl (E)-3-[2,5-bis(2-ethenoxyethoxy)phenyl]-2-cyanoprop-2-enoate.
| Compound Name | methyl (E)-3-[2,5-bis(2-ethenoxyethoxy)phenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 102507389 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | methyl (E)-3-[2,5-bis(2-ethenoxyethoxy)phenyl]-2-cyanoprop-2-enoate |
| SMILES | C=COCCOc1ccc(OCCOC=C)c(/C=C(\C#N)C(=O)OC)c1 |
| InChI | InChI=1S/C19H21NO6/c1-4-23-8-10-25-17-6-7-18(26-11-9-24-5-2)15(13-17)12-16(14-20)19(21)22-3/h4-7,12-13H,1-2,8-11H2,3H3/b16-12+ |
| InChIKey | HQBVIWKRSSNSDH-FOWTUZBSSA-N |
| XLogP | 2.84 |
| TPSA | 87.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|