C34H56O4 — CID 177485755
(1R,5S,8R,9R,16S,19R)-19-ethoxy-8-[(E,2R)-6-ethoxy-6-methylhept-4-en-2-yl]-5,9,17,17-tetramethyl-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-16-ol (PubChem CID 177485755) has the molecular formula C34H56O4 and a molecular weight of 528.82 g/mol. Its IUPAC name is (1R,5S,8R,9R,16S,19R)-19-ethoxy-8-[(E,2R)-6-ethoxy-6-methylhept-4-en-2-yl]-5,9,17,17-tetramethyl-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-16-ol.
| Compound Name | (1R,5S,8R,9R,16S,19R)-19-ethoxy-8-[(E,2R)-6-ethoxy-6-methylhept-4-en-2-yl]-5,9,17,17-tetramethyl-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-16-ol |
|---|---|
| PubChem CID | 177485755 |
| Molecular Formula | C34H56O4 |
| Molecular Weight | 528.82 g/mol |
| Exact Mass | 528.42 |
| IUPAC Name | (1R,5S,8R,9R,16S,19R)-19-ethoxy-8-[(E,2R)-6-ethoxy-6-methylhept-4-en-2-yl]-5,9,17,17-tetramethyl-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-16-ol |
| SMILES | CCO[C@@H]1O[C@]23C=CC4C1(CC[C@]1(C)[C@@H]([C@H](C)C/C=C/C(C)(C)OCC)CC[C@@]41C)C2CC[C@H](O)C3(C)C |
| InChI | InChI=1S/C34H56O4/c1-10-36-28-33-22-21-31(8)24(23(3)13-12-18-29(4,5)37-11-2)16-19-32(31,9)25(33)17-20-34(38-28)26(33)14-15-27(35)30(34,6)7/h12,17-18,20,23-28,35H,10-11,13-16,19,21-22H2,1-9H3/b18-12+/t23-,24-,25?,26?,27+,28-,31-,32+,33?,34-/m1/s1 |
| InChIKey | DKKVGVGJXLLCQP-NFRNZMAKSA-N |
| XLogP | 7.70 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.82 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|