C23H27NO4 — CID 177485979
2-[(E)-[(8S,13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetic acid (PubChem CID 177485979) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 2-[(E)-[(8S,13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetic acid.
| Compound Name | 2-[(E)-[(8S,13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 177485979 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-[(E)-[(8S,13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetic acid |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=C/C(=N/OCC(=O)O)CCC4=C3C=C[C@@]21CC |
| InChI | InChI=1S/C23H27NO4/c1-3-22-11-9-18-17-8-6-16(24-28-14-21(25)26)13-15(17)5-7-19(18)20(22)10-12-23(22,27)4-2/h2,9,11,13,19-20,27H,3,5-8,10,12,14H2,1H3,(H,25,26)/b24-16+/t19-,20+,22+,23+/m1/s1 |
| InChIKey | ZEGXWDKMEOJOJQ-ATWXIHTPSA-N |
| XLogP | 3.61 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|