C22H30O3S — CID 70348629
(8S,13S,14S,17S)-17-hydroxy-17-(methylsulfinylmethyl)-13-propyl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70348629) has the molecular formula C22H30O3S and a molecular weight of 374.55 g/mol. Its IUPAC name is (8S,13S,14S,17S)-17-hydroxy-17-(methylsulfinylmethyl)-13-propyl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,13S,14S,17S)-17-hydroxy-17-(methylsulfinylmethyl)-13-propyl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70348629 |
| Molecular Formula | C22H30O3S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (8S,13S,14S,17S)-17-hydroxy-17-(methylsulfinylmethyl)-13-propyl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCC[C@]12C=CC3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@@]2(O)CS(C)=O |
| InChI | InChI=1S/C22H30O3S/c1-3-10-21-11-8-18-17-7-5-16(23)13-15(17)4-6-19(18)20(21)9-12-22(21,24)14-26(2)25/h8,11,13,19-20,24H,3-7,9-10,12,14H2,1-2H3/t19-,20+,21+,22-,26?/m1/s1 |
| InChIKey | YKCZJCPVORPVSD-RCMFUJIFSA-N |
| XLogP | 3.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |