C22H30O — CID 174178247
(13S,14S,17R)-13,17-dimethyl-17-propan-2-yl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 174178247) has the molecular formula C22H30O and a molecular weight of 310.48 g/mol. Its IUPAC name is (13S,14S,17R)-13,17-dimethyl-17-propan-2-yl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (13S,14S,17R)-13,17-dimethyl-17-propan-2-yl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 174178247 |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (13S,14S,17R)-13,17-dimethyl-17-propan-2-yl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)[C@@]1(C)CC[C@H]2C3CCC4=CC(=O)CCC4=C3C=C[C@@]21C |
| InChI | InChI=1S/C22H30O/c1-14(2)21(3)12-10-20-19-7-5-15-13-16(23)6-8-17(15)18(19)9-11-22(20,21)4/h9,11,13-14,19-20H,5-8,10,12H2,1-4H3/t19?,20-,21+,22-/m0/s1 |
| InChIKey | JJUUGTBPQARUOI-KBRMVUAJSA-N |
| XLogP | 5.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |