C19H24BO2 — CID 174008770
CID 174008770 (PubChem CID 174008770) has the molecular formula C19H24BO2 and a molecular weight of 295.21 g/mol.
| Compound Name | CID 174008770 |
|---|---|
| PubChem CID | 174008770 |
| Molecular Formula | C19H24BO2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | — |
| SMILES | C[B]OC1CCC2C3CCC4=CC(=O)CCC4=C3C=CC12C |
| InChI | InChI=1S/C19H24BO2/c1-19-10-9-15-14-6-4-13(21)11-12(14)3-5-16(15)17(19)7-8-18(19)22-20-2/h9-11,16-18H,3-8H2,1-2H3 |
| InChIKey | WJNRSBMONMLCTB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|