C20H24O3S — CID 90475759
(8S,13S,14S,17R)-13-methyl-2'-oxospiro[1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxathiolane]-3-one (PubChem CID 90475759) has the molecular formula C20H24O3S and a molecular weight of 344.48 g/mol. Its IUPAC name is (8S,13S,14S,17R)-13-methyl-2'-oxospiro[1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxathiolane]-3-one.
| Compound Name | (8S,13S,14S,17R)-13-methyl-2'-oxospiro[1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxathiolane]-3-one |
|---|---|
| PubChem CID | 90475759 |
| Molecular Formula | C20H24O3S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (8S,13S,14S,17R)-13-methyl-2'-oxospiro[1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxathiolane]-3-one |
| SMILES | C[C@]12C=CC3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@@]21CCS(=O)O1 |
| InChI | InChI=1S/C20H24O3S/c1-19-8-6-16-15-5-3-14(21)12-13(15)2-4-17(16)18(19)7-9-20(19)10-11-24(22)23-20/h6,8,12,17-18H,2-5,7,9-11H2,1H3/t17-,18+,19+,20-,24?/m1/s1 |
| InChIKey | LASNAPSEPQIKIZ-FPVQTCHTSA-N |
| XLogP | 3.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |