C17H14N2O5 — CID 177487292
2-[(4E)-4-[(1-methoxynaphthalen-2-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetic acid (PubChem CID 177487292) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-[(4E)-4-[(1-methoxynaphthalen-2-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[(4E)-4-[(1-methoxynaphthalen-2-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 177487292 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[(4E)-4-[(1-methoxynaphthalen-2-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetic acid |
| SMILES | COc1c(/C=C2/NC(=O)N(CC(=O)O)C2=O)ccc2ccccc12 |
| InChI | InChI=1S/C17H14N2O5/c1-24-15-11(7-6-10-4-2-3-5-12(10)15)8-13-16(22)19(9-14(20)21)17(23)18-13/h2-8H,9H2,1H3,(H,18,23)(H,20,21)/b13-8+ |
| InChIKey | BINLNZXIQLYHPB-MDWZMJQESA-N |
| XLogP | 1.83 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|