C15H28O3Si — CID 177488499
8-(1-trimethylsilylbut-3-en-2-yl)-1,4-dioxaspiro[4.5]decan-8-ol (PubChem CID 177488499) has the molecular formula C15H28O3Si and a molecular weight of 284.47 g/mol. Its IUPAC name is 8-(1-trimethylsilylbut-3-en-2-yl)-1,4-dioxaspiro[4.5]decan-8-ol.
| Compound Name | 8-(1-trimethylsilylbut-3-en-2-yl)-1,4-dioxaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 177488499 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 8-(1-trimethylsilylbut-3-en-2-yl)-1,4-dioxaspiro[4.5]decan-8-ol |
| SMILES | C=CC(C[Si](C)(C)C)C1(O)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H28O3Si/c1-5-13(12-19(2,3)4)14(16)6-8-15(9-7-14)17-10-11-18-15/h5,13,16H,1,6-12H2,2-4H3 |
| InChIKey | QYIWZJKKRQJMSJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|