C21H25O2P — CID 177489952
ethyl (2R,3R)-1,5,6,7,8-pentamethyl-3-phenyl-4-phosphatetracyclo[3.3.0.02,4.03,6]oct-7-ene-2-carboxylate (PubChem CID 177489952) has the molecular formula C21H25O2P and a molecular weight of 340.40 g/mol. Its IUPAC name is ethyl (2R,3R)-1,5,6,7,8-pentamethyl-3-phenyl-4-phosphatetracyclo[3.3.0.02,4.03,6]oct-7-ene-2-carboxylate.
| Compound Name | ethyl (2R,3R)-1,5,6,7,8-pentamethyl-3-phenyl-4-phosphatetracyclo[3.3.0.02,4.03,6]oct-7-ene-2-carboxylate |
|---|---|
| PubChem CID | 177489952 |
| Molecular Formula | C21H25O2P |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | ethyl (2R,3R)-1,5,6,7,8-pentamethyl-3-phenyl-4-phosphatetracyclo[3.3.0.02,4.03,6]oct-7-ene-2-carboxylate |
| SMILES | CCOC(=O)C12P3C4(C)C1(C)C(C)=C(C)C4(C)C32c1ccccc1 |
| InChI | InChI=1S/C21H25O2P/c1-7-23-16(22)21-18(5)14(3)13(2)17(4)19(18,6)24(21)20(17,21)15-11-9-8-10-12-15/h8-12H,7H2,1-6H3 |
| InChIKey | OABRAFXRLGASPV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|