C29H18F4O8 — CID 177493036
[(2R,3R)-5-(3,4-difluorobenzoyl)oxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4-difluorobenzoate (PubChem CID 177493036) has the molecular formula C29H18F4O8 and a molecular weight of 570.45 g/mol. Its IUPAC name is [(2R,3R)-5-(3,4-difluorobenzoyl)oxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4-difluorobenzoate.
| Compound Name | [(2R,3R)-5-(3,4-difluorobenzoyl)oxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4-difluorobenzoate |
|---|---|
| PubChem CID | 177493036 |
| Molecular Formula | C29H18F4O8 |
| Molecular Weight | 570.45 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | [(2R,3R)-5-(3,4-difluorobenzoyl)oxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4-difluorobenzoate |
| SMILES | O=C(Oc1cc(O)cc2c1C[C@@H](OC(=O)c1ccc(F)c(F)c1)[C@@H](c1ccc(O)c(O)c1)O2)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C29H18F4O8/c30-18-4-1-14(7-20(18)32)28(37)40-25-11-16(34)10-24-17(25)12-26(27(39-24)13-3-6-22(35)23(36)9-13)41-29(38)15-2-5-19(31)21(33)8-15/h1-11,26-27,34-36H,12H2/t26-,27-/m1/s1 |
| InChIKey | UKRBUZHVLVGBPO-KAYWLYCHSA-N |
| XLogP | 5.48 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|