C12H20O3S2 — CID 177494056
(4R)-6-[2-(1,3-dithian-2-yl)propan-2-yl]-4-hydroxyoxan-2-one (PubChem CID 177494056) has the molecular formula C12H20O3S2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (4R)-6-[2-(1,3-dithian-2-yl)propan-2-yl]-4-hydroxyoxan-2-one.
| Compound Name | (4R)-6-[2-(1,3-dithian-2-yl)propan-2-yl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 177494056 |
| Molecular Formula | C12H20O3S2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (4R)-6-[2-(1,3-dithian-2-yl)propan-2-yl]-4-hydroxyoxan-2-one |
| SMILES | CC(C)(C1C[C@@H](O)CC(=O)O1)C1SCCCS1 |
| InChI | InChI=1S/C12H20O3S2/c1-12(2,11-16-4-3-5-17-11)9-6-8(13)7-10(14)15-9/h8-9,11,13H,3-7H2,1-2H3/t8-,9?/m1/s1 |
| InChIKey | PNRPLBLNBOFHDM-VEDVMXKPSA-N |
| XLogP | 2.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |