C13H20O6 — CID 177495565
diethyl (4R,9R)-1,6-dioxaspiro[4.4]nonane-4,9-dicarboxylate (PubChem CID 177495565) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is diethyl (4R,9R)-1,6-dioxaspiro[4.4]nonane-4,9-dicarboxylate.
| Compound Name | diethyl (4R,9R)-1,6-dioxaspiro[4.4]nonane-4,9-dicarboxylate |
|---|---|
| PubChem CID | 177495565 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | diethyl (4R,9R)-1,6-dioxaspiro[4.4]nonane-4,9-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CCOC12OCC[C@H]2C(=O)OCC |
| InChI | InChI=1S/C13H20O6/c1-3-16-11(14)9-5-7-18-13(9)10(6-8-19-13)12(15)17-4-2/h9-10H,3-8H2,1-2H3/t9-,10-,13?/m0/s1 |
| InChIKey | QLBJTBBGSMLSCJ-UCBNGSGESA-N |
| XLogP | 0.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |