C22H32O4 — CID 177495943
(9E,22E)-7,12,20,25-tetraoxadispiro[4.8.414.85]hexacosa-2,9,16,22-tetraene (PubChem CID 177495943) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (9E,22E)-7,12,20,25-tetraoxadispiro[4.8.414.85]hexacosa-2,9,16,22-tetraene.
| Compound Name | (9E,22E)-7,12,20,25-tetraoxadispiro[4.8.414.85]hexacosa-2,9,16,22-tetraene |
|---|---|
| PubChem CID | 177495943 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (9E,22E)-7,12,20,25-tetraoxadispiro[4.8.414.85]hexacosa-2,9,16,22-tetraene |
| SMILES | C1=CCC2(C1)COC/C=C/COCC1(CC=CC1)COC/C=C/COC2 |
| InChI | InChI=1S/C22H32O4/c1-2-10-21(9-1)17-23-13-5-7-15-25-19-22(11-3-4-12-22)20-26-16-8-6-14-24-18-21/h1-8H,9-20H2/b7-5+,8-6+ |
| InChIKey | ITFJSARDHDZVNL-KQQUZDAGSA-N |
| XLogP | 3.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|