C17H28O2 — CID 101200823
(2E,7E)-5,5-bis(prop-2-enoxymethyl)nona-2,7-diene (PubChem CID 101200823) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (2E,7E)-5,5-bis(prop-2-enoxymethyl)nona-2,7-diene.
| Compound Name | (2E,7E)-5,5-bis(prop-2-enoxymethyl)nona-2,7-diene |
|---|---|
| PubChem CID | 101200823 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (2E,7E)-5,5-bis(prop-2-enoxymethyl)nona-2,7-diene |
| SMILES | C=CCOCC(C/C=C/C)(C/C=C/C)COCC=C |
| InChI | InChI=1S/C17H28O2/c1-5-9-11-17(12-10-6-2,15-18-13-7-3)16-19-14-8-4/h5-10H,3-4,11-16H2,1-2H3/b9-5+,10-6+ |
| InChIKey | IIHKOBCNQAARTE-NXZHAISVSA-N |
| XLogP | 4.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|