C23H24N6O5 — CID 177497569
5-amino-7-(3-methoxyphenyl)-N-[(E)-(3-methoxyphenyl)methylideneamino]-8-nitro-1,2,3,7-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 177497569) has the molecular formula C23H24N6O5 and a molecular weight of 464.48 g/mol. Its IUPAC name is 5-amino-7-(3-methoxyphenyl)-N-[(E)-(3-methoxyphenyl)methylideneamino]-8-nitro-1,2,3,7-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 5-amino-7-(3-methoxyphenyl)-N-[(E)-(3-methoxyphenyl)methylideneamino]-8-nitro-1,2,3,7-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 177497569 |
| Molecular Formula | C23H24N6O5 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 5-amino-7-(3-methoxyphenyl)-N-[(E)-(3-methoxyphenyl)methylideneamino]-8-nitro-1,2,3,7-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | COc1cccc(/C=N/NC(=O)C2=C(N)N3CCNC3=C([N+](=O)[O-])C2c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C23H24N6O5/c1-33-16-7-3-5-14(11-16)13-26-27-23(30)19-18(15-6-4-8-17(12-15)34-2)20(29(31)32)22-25-9-10-28(22)21(19)24/h3-8,11-13,18,25H,9-10,24H2,1-2H3,(H,27,30)/b26-13+ |
| InChIKey | OTENPTSRURRXEK-LGJNPRDNSA-N |
| XLogP | 1.47 |
| TPSA | 144.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|