C13H4F4IN — CID 177497894
2-[2-(2,3,4,5-tetrafluoro-6-iodophenyl)ethynyl]pyridine (PubChem CID 177497894) has the molecular formula C13H4F4IN and a molecular weight of 377.08 g/mol. Its IUPAC name is 2-[2-(2,3,4,5-tetrafluoro-6-iodophenyl)ethynyl]pyridine.
| Compound Name | 2-[2-(2,3,4,5-tetrafluoro-6-iodophenyl)ethynyl]pyridine |
|---|---|
| PubChem CID | 177497894 |
| Molecular Formula | C13H4F4IN |
| Molecular Weight | 377.08 g/mol |
| Exact Mass | 376.93 |
| IUPAC Name | 2-[2-(2,3,4,5-tetrafluoro-6-iodophenyl)ethynyl]pyridine |
| SMILES | Fc1c(F)c(F)c(C#Cc2ccccn2)c(I)c1F |
| InChI | InChI=1S/C13H4F4IN/c14-9-8(5-4-7-3-1-2-6-19-7)13(18)12(17)11(16)10(9)15/h1-3,6H |
| InChIKey | XBUIWZOGJZYFAR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.08 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|