C23H25N3O5 — CID 177498904
benzyl 2-[(3S)-3-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2,6-dioxopiperidin-1-yl]acetate (PubChem CID 177498904) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is benzyl 2-[(3S)-3-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2,6-dioxopiperidin-1-yl]acetate.
| Compound Name | benzyl 2-[(3S)-3-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2,6-dioxopiperidin-1-yl]acetate |
|---|---|
| PubChem CID | 177498904 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | benzyl 2-[(3S)-3-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2,6-dioxopiperidin-1-yl]acetate |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@H]1CCC(=O)N(CC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C23H25N3O5/c24-18(13-16-7-3-1-4-8-16)22(29)25-19-11-12-20(27)26(23(19)30)14-21(28)31-15-17-9-5-2-6-10-17/h1-10,18-19H,11-15,24H2,(H,25,29)/t18-,19-/m0/s1 |
| InChIKey | AXKXWRULDYCQOF-OALUTQOASA-N |
| XLogP | 0.93 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|