C29H26FN7O4S — CID 178002103
N-(2-fluorophenyl)-2-[[3-methoxy-6-[(10R)-12-prop-2-enoyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 178002103) has the molecular formula C29H26FN7O4S and a molecular weight of 587.64 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[[3-methoxy-6-[(10R)-12-prop-2-enoyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-fluorophenyl)-2-[[3-methoxy-6-[(10R)-12-prop-2-enoyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 178002103 |
| Molecular Formula | C29H26FN7O4S |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | N-(2-fluorophenyl)-2-[[3-methoxy-6-[(10R)-12-prop-2-enoyl-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | C=CC(=O)N1CCN2c3ncc(-c4ccc(OC)c(Nc5ncc(C(=O)Nc6ccccc6F)s5)n4)cc3OC[C@H]2C1 |
| InChI | InChI=1S/C29H26FN7O4S/c1-3-25(38)36-10-11-37-18(15-36)16-41-23-12-17(13-31-27(23)37)20-8-9-22(40-2)26(33-20)35-29-32-14-24(42-29)28(39)34-21-7-5-4-6-19(21)30/h3-9,12-14,18H,1,10-11,15-16H2,2H3,(H,34,39)(H,32,33,35)/t18-/m1/s1 |
| InChIKey | XSRWJEDQVAWKOV-GOSISDBHSA-N |
| XLogP | 4.34 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|