C30H40N6O2S — CID 178004608
cyclohexanamine;1-[1-methyl-6-[1-[(3-sulfanylphenyl)methyl]piperidin-4-yl]indazol-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 178004608) has the molecular formula C30H40N6O2S and a molecular weight of 548.76 g/mol. Its IUPAC name is cyclohexanamine;1-[1-methyl-6-[1-[(3-sulfanylphenyl)methyl]piperidin-4-yl]indazol-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | cyclohexanamine;1-[1-methyl-6-[1-[(3-sulfanylphenyl)methyl]piperidin-4-yl]indazol-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 178004608 |
| Molecular Formula | C30H40N6O2S |
| Molecular Weight | 548.76 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | cyclohexanamine;1-[1-methyl-6-[1-[(3-sulfanylphenyl)methyl]piperidin-4-yl]indazol-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | Cn1nc(N2CCC(=O)NC2=O)c2ccc(C3CCN(Cc4cccc(S)c4)CC3)cc21.NC1CCCCC1 |
| InChI | InChI=1S/C24H27N5O2S.C6H13N/c1-27-21-14-18(5-6-20(21)23(26-27)29-12-9-22(30)25-24(29)31)17-7-10-28(11-8-17)15-16-3-2-4-19(32)13-16;7-6-4-2-1-3-5-6/h2-6,13-14,17,32H,7-12,15H2,1H3,(H,25,30,31);6H,1-5,7H2 |
| InChIKey | DMRXRERQCMEQOM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.76 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|