C25H19F3N4O3S — CID 178007326
4-[3-[2,6-difluoro-3-(pyrrolidin-1-ylsulfanylamino)benzoyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-fluoro-6-hydroxybenzaldehyde (PubChem CID 178007326) has the molecular formula C25H19F3N4O3S and a molecular weight of 512.51 g/mol. Its IUPAC name is 4-[3-[2,6-difluoro-3-(pyrrolidin-1-ylsulfanylamino)benzoyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-fluoro-6-hydroxybenzaldehyde.
| Compound Name | 4-[3-[2,6-difluoro-3-(pyrrolidin-1-ylsulfanylamino)benzoyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-fluoro-6-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 178007326 |
| Molecular Formula | C25H19F3N4O3S |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 4-[3-[2,6-difluoro-3-(pyrrolidin-1-ylsulfanylamino)benzoyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-fluoro-6-hydroxybenzaldehyde |
| SMILES | O=Cc1c(O)cc(-c2cnc3[nH]cc(C(=O)c4c(F)ccc(NSN5CCCC5)c4F)c3c2)cc1F |
| InChI | InChI=1S/C25H19F3N4O3S/c26-18-3-4-20(31-36-32-5-1-2-6-32)23(28)22(18)24(35)16-11-30-25-15(16)7-14(10-29-25)13-8-19(27)17(12-33)21(34)9-13/h3-4,7-12,31,34H,1-2,5-6H2,(H,29,30) |
| InChIKey | BOOREKHOCSJPSH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|