C13H17F3N2O4 — CID 178008437
6-propan-2-yl-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol (PubChem CID 178008437) has the molecular formula C13H17F3N2O4 and a molecular weight of 322.28 g/mol. Its IUPAC name is 6-propan-2-yl-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol.
| Compound Name | 6-propan-2-yl-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol |
|---|---|
| PubChem CID | 178008437 |
| Molecular Formula | C13H17F3N2O4 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 6-propan-2-yl-5-[6-(trifluoromethyl)pyrazin-2-yl]oxyoxane-3,4-diol |
| SMILES | CC(C)C1OCC(O)C(O)C1Oc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H17F3N2O4/c1-6(2)11-12(10(20)7(19)5-21-11)22-9-4-17-3-8(18-9)13(14,15)16/h3-4,6-7,10-12,19-20H,5H2,1-2H3 |
| InChIKey | DSOPDVDYIMCYII-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |