C14H18F3NO3S — CID 178008453
2-propyl-5-[[6-(trifluoromethyl)-2-pyridinyl]sulfanyl]oxane-3,4-diol (PubChem CID 178008453) has the molecular formula C14H18F3NO3S and a molecular weight of 337.36 g/mol. Its IUPAC name is 2-propyl-5-[[6-(trifluoromethyl)-2-pyridinyl]sulfanyl]oxane-3,4-diol.
| Compound Name | 2-propyl-5-[[6-(trifluoromethyl)-2-pyridinyl]sulfanyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 178008453 |
| Molecular Formula | C14H18F3NO3S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-propyl-5-[[6-(trifluoromethyl)-2-pyridinyl]sulfanyl]oxane-3,4-diol |
| SMILES | CCCC1OCC(Sc2cccc(C(F)(F)F)n2)C(O)C1O |
| InChI | InChI=1S/C14H18F3NO3S/c1-2-4-8-12(19)13(20)9(7-21-8)22-11-6-3-5-10(18-11)14(15,16)17/h3,5-6,8-9,12-13,19-20H,2,4,7H2,1H3 |
| InChIKey | MTMLNKGJXAHELY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |