C25H27F4N5O — CID 178010978
N-[(E)-3-[5-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-3-yl]prop-2-enyl]-4-methyl-1,3-oxazol-2-amine (PubChem CID 178010978) has the molecular formula C25H27F4N5O and a molecular weight of 489.52 g/mol. Its IUPAC name is N-[(E)-3-[5-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-3-yl]prop-2-enyl]-4-methyl-1,3-oxazol-2-amine.
| Compound Name | N-[(E)-3-[5-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-3-yl]prop-2-enyl]-4-methyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 178010978 |
| Molecular Formula | C25H27F4N5O |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | N-[(E)-3-[5-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-3-yl]prop-2-enyl]-4-methyl-1,3-oxazol-2-amine |
| SMILES | C=C(c1nc(/C=C/CNc2nc(C)co2)cc2c(N[C@@H]3CCN(C)C[C@@H]3F)cccc12)C(F)(F)F |
| InChI | InChI=1S/C25H27F4N5O/c1-15-14-35-24(31-15)30-10-5-6-17-12-19-18(23(32-17)16(2)25(27,28)29)7-4-8-21(19)33-22-9-11-34(3)13-20(22)26/h4-8,12,14,20,22,33H,2,9-11,13H2,1,3H3,(H,30,31)/b6-5+/t20-,22+/m0/s1 |
| InChIKey | IBSPQFGJCBSNEJ-KJXQILNXSA-N |
| XLogP | 5.69 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |