C25H27F4N5OS — CID 178011545
N-[3-[5-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-3-yl]propyl]-1,3-thiazole-5-carboxamide (PubChem CID 178011545) has the molecular formula C25H27F4N5OS and a molecular weight of 521.58 g/mol. Its IUPAC name is N-[3-[5-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-3-yl]propyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[3-[5-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-3-yl]propyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 178011545 |
| Molecular Formula | C25H27F4N5OS |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | N-[3-[5-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-3-yl]propyl]-1,3-thiazole-5-carboxamide |
| SMILES | C=C(c1nc(CCCNC(=O)c2cncs2)cc2c(N[C@@H]3CCN(C)C[C@@H]3F)cccc12)C(F)(F)F |
| InChI | InChI=1S/C25H27F4N5OS/c1-15(25(27,28)29)23-17-6-3-7-20(33-21-8-10-34(2)13-19(21)26)18(17)11-16(32-23)5-4-9-31-24(35)22-12-30-14-36-22/h3,6-7,11-12,14,19,21,33H,1,4-5,8-10,13H2,2H3,(H,31,35)/t19-,21+/m0/s1 |
| InChIKey | KZNNCYLQOFWDBH-PZJWPPBQSA-N |
| XLogP | 5.08 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|