C27H31ClF3N7O2 — CID 178012320
3-chloro-5-[[2-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)purin-9-yl]methyl]-4-(trifluoromethyl)phenol (PubChem CID 178012320) has the molecular formula C27H31ClF3N7O2 and a molecular weight of 578.04 g/mol. Its IUPAC name is 3-chloro-5-[[2-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)purin-9-yl]methyl]-4-(trifluoromethyl)phenol.
| Compound Name | 3-chloro-5-[[2-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)purin-9-yl]methyl]-4-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 178012320 |
| Molecular Formula | C27H31ClF3N7O2 |
| Molecular Weight | 578.04 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 3-chloro-5-[[2-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)purin-9-yl]methyl]-4-(trifluoromethyl)phenol |
| SMILES | Oc1cc(Cl)c(C(F)(F)F)c(Cn2cnc3c(OCC45CCCN4CCC5)nc(N4CC5CCC(C4)N5)nc32)c1 |
| InChI | InChI=1S/C27H31ClF3N7O2/c28-20-10-19(39)9-16(21(20)27(29,30)31)11-37-15-32-22-23(37)34-25(36-12-17-3-4-18(13-36)33-17)35-24(22)40-14-26-5-1-7-38(26)8-2-6-26/h9-10,15,17-18,33,39H,1-8,11-14H2 |
| InChIKey | FSXIWTKZEAGWBN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.04 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |