C16H10F2N2O — CID 178012555
8-(difluoromethoxy)-11H-indolo[3,2-c]isoquinoline (PubChem CID 178012555) has the molecular formula C16H10F2N2O and a molecular weight of 284.27 g/mol. Its IUPAC name is 8-(difluoromethoxy)-11H-indolo[3,2-c]isoquinoline.
| Compound Name | 8-(difluoromethoxy)-11H-indolo[3,2-c]isoquinoline |
|---|---|
| PubChem CID | 178012555 |
| Molecular Formula | C16H10F2N2O |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 8-(difluoromethoxy)-11H-indolo[3,2-c]isoquinoline |
| SMILES | FC(F)Oc1ccc2[nH]c3c4ccccc4cnc3c2c1 |
| InChI | InChI=1S/C16H10F2N2O/c17-16(18)21-10-5-6-13-12(7-10)14-15(20-13)11-4-2-1-3-9(11)8-19-14/h1-8,16,20H |
| InChIKey | WNPALCIZALFLGO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |