C18H23NOS2 — CID 178014045
(S)-2-methyl-N-[(1S)-1-[2-[(E)-2-thiophen-2-ylethenyl]phenyl]ethyl]propane-2-sulfinamide (PubChem CID 178014045) has the molecular formula C18H23NOS2 and a molecular weight of 333.52 g/mol. Its IUPAC name is (S)-2-methyl-N-[(1S)-1-[2-[(E)-2-thiophen-2-ylethenyl]phenyl]ethyl]propane-2-sulfinamide.
| Compound Name | (S)-2-methyl-N-[(1S)-1-[2-[(E)-2-thiophen-2-ylethenyl]phenyl]ethyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 178014045 |
| Molecular Formula | C18H23NOS2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (S)-2-methyl-N-[(1S)-1-[2-[(E)-2-thiophen-2-ylethenyl]phenyl]ethyl]propane-2-sulfinamide |
| SMILES | C[C@H](N[S@@](=O)C(C)(C)C)c1ccccc1/C=C/c1cccs1 |
| InChI | InChI=1S/C18H23NOS2/c1-14(19-22(20)18(2,3)4)17-10-6-5-8-15(17)11-12-16-9-7-13-21-16/h5-14,19H,1-4H3/b12-11+/t14-,22-/m0/s1 |
| InChIKey | WTAKMCQVOGRSMY-NRYQGRDJSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |