C17H31BrN3PS — CID 178014100
1-[2-bromo-4-(4-methylpiperazin-1-yl)phenyl]ethanamine;tert-butylsulfanylphosphane (PubChem CID 178014100) has the molecular formula C17H31BrN3PS and a molecular weight of 420.40 g/mol. Its IUPAC name is 1-[2-bromo-4-(4-methylpiperazin-1-yl)phenyl]ethanamine;tert-butylsulfanylphosphane.
| Compound Name | 1-[2-bromo-4-(4-methylpiperazin-1-yl)phenyl]ethanamine;tert-butylsulfanylphosphane |
|---|---|
| PubChem CID | 178014100 |
| Molecular Formula | C17H31BrN3PS |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 1-[2-bromo-4-(4-methylpiperazin-1-yl)phenyl]ethanamine;tert-butylsulfanylphosphane |
| SMILES | CC(C)(C)SP.CC(N)c1ccc(N2CCN(C)CC2)cc1Br |
| InChI | InChI=1S/C13H20BrN3.C4H11PS/c1-10(15)12-4-3-11(9-13(12)14)17-7-5-16(2)6-8-17;1-4(2,3)6-5/h3-4,9-10H,5-8,15H2,1-2H3;5H2,1-3H3 |
| InChIKey | LGYMIIQSOQXVGY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|