C8H9ClN2O — CID 178014645
(1E,3Z)-1-chloro-4-(furan-2-yl)buta-1,3-diene-1,4-diamine (PubChem CID 178014645) has the molecular formula C8H9ClN2O and a molecular weight of 184.63 g/mol. Its IUPAC name is (1E,3Z)-1-chloro-4-(furan-2-yl)buta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-chloro-4-(furan-2-yl)buta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 178014645 |
| Molecular Formula | C8H9ClN2O |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | (1E,3Z)-1-chloro-4-(furan-2-yl)buta-1,3-diene-1,4-diamine |
| SMILES | N/C(=C\C=C(/N)Cl)c1ccco1 |
| InChI | InChI=1S/C8H9ClN2O/c9-8(11)4-3-6(10)7-2-1-5-12-7/h1-5H,10-11H2/b6-3-,8-4- |
| InChIKey | HKBFTCSRAPXNEM-IJXUMNLFSA-N |
| XLogP | 1.62 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|