C8H7F3N2O — CID 162584999
(Z)-4,4,4-trifluoro-1-(furan-2-yl)-3-iminobut-1-en-1-amine (PubChem CID 162584999) has the molecular formula C8H7F3N2O and a molecular weight of 204.15 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-1-(furan-2-yl)-3-iminobut-1-en-1-amine.
| Compound Name | (Z)-4,4,4-trifluoro-1-(furan-2-yl)-3-iminobut-1-en-1-amine |
|---|---|
| PubChem CID | 162584999 |
| Molecular Formula | C8H7F3N2O |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | (Z)-4,4,4-trifluoro-1-(furan-2-yl)-3-iminobut-1-en-1-amine |
| SMILES | [H]/N=C(/C=C(\N)c1ccco1)C(F)(F)F |
| InChI | InChI=1S/C8H7F3N2O/c9-8(10,11)7(13)4-5(12)6-2-1-3-14-6/h1-4,13H,12H2/b5-4-,13-7- |
| InChIKey | GYYCHWSUPSDINV-HJQJRMHTSA-N |
| XLogP | 2.16 |
| TPSA | 63.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|