About CID 131873391
CID 131873391 (PubChem CID 131873391) has the molecular formula C16H8F6MnO6
and a molecular weight of 465.16 g/mol.
Molecular Properties
| Compound Name | CID 131873391 |
| PubChem CID | 131873391 |
| Molecular Formula | C16H8F6MnO6 |
| Molecular Weight | 465.16 g/mol |
| Exact Mass | 464.96 |
| IUPAC Name | — |
| SMILES | O=C([CH-]C(=O)C(F)(F)F)c1ccco1.O=C([CH-]C(=O)C(F)(F)F)c1ccco1.[Mn+2] |
| InChI | InChI=1S/2C8H4F3O3.Mn/c2*9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h2*1-4H;/q2*-1;+2 |
| InChIKey | QZJJYGTTXARPFI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.16 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 131873391 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131873391?
The IUPAC name of CID 131873391 (CID 131873391) is not available.
What is the SMILES notation for CID 131873391?
The canonical SMILES for CID 131873391 is O=C([CH-]C(=O)C(F)(F)F)c1ccco1.O=C([CH-]C(=O)C(F)(F)F)c1ccco1.[Mn+2].
What is the InChIKey of CID 131873391?
The InChIKey is QZJJYGTTXARPFI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H4F3O3.Mn/c2*9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h2*1-4H;/q2*-1;+2.
What are the key properties of CID 131873391?
CID 131873391 has a molecular weight of 465.16 g/mol, XLogP of 3.59, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131873391 is sourced from PubChem (CID 131873391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).