C31H42F2N8O5S — CID 178017752
4-[6-[4-[3-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]piperidin-1-yl]sulfanylpropyl]piperazin-1-yl]-5-methyl-2-oxo-1,3-benzoxazol-3-yl]-N-methyl-5-oxopentanamide (PubChem CID 178017752) has the molecular formula C31H42F2N8O5S and a molecular weight of 676.79 g/mol. Its IUPAC name is 4-[6-[4-[3-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]piperidin-1-yl]sulfanylpropyl]piperazin-1-yl]-5-methyl-2-oxo-1,3-benzoxazol-3-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 4-[6-[4-[3-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]piperidin-1-yl]sulfanylpropyl]piperazin-1-yl]-5-methyl-2-oxo-1,3-benzoxazol-3-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 178017752 |
| Molecular Formula | C31H42F2N8O5S |
| Molecular Weight | 676.79 g/mol |
| Exact Mass | 676.30 |
| IUPAC Name | 4-[6-[4-[3-[4-[[5-(difluoromethoxy)pyrimidin-2-yl]amino]piperidin-1-yl]sulfanylpropyl]piperazin-1-yl]-5-methyl-2-oxo-1,3-benzoxazol-3-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)CCC(C=O)n1c(=O)oc2cc(N3CCN(CCCSN4CCC(Nc5ncc(OC(F)F)cn5)CC4)CC3)c(C)cc21 |
| InChI | InChI=1S/C31H42F2N8O5S/c1-21-16-26-27(46-31(44)41(26)23(20-42)4-5-28(43)34-2)17-25(21)39-13-11-38(12-14-39)8-3-15-47-40-9-6-22(7-10-40)37-30-35-18-24(19-36-30)45-29(32)33/h16-20,22-23,29H,3-15H2,1-2H3,(H,34,43)(H,35,36,37) |
| InChIKey | BUARONQYLQVLAF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.79 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|