C22H36ClN7OS — CID 178020089
2-[[6-[4-(2-chloroethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carbaldehyde;N,3-dimethylbut-2-en-2-amine;ethane (PubChem CID 178020089) has the molecular formula C22H36ClN7OS and a molecular weight of 482.10 g/mol. Its IUPAC name is 2-[[6-[4-(2-chloroethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carbaldehyde;N,3-dimethylbut-2-en-2-amine;ethane.
| Compound Name | 2-[[6-[4-(2-chloroethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carbaldehyde;N,3-dimethylbut-2-en-2-amine;ethane |
|---|---|
| PubChem CID | 178020089 |
| Molecular Formula | C22H36ClN7OS |
| Molecular Weight | 482.10 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 2-[[6-[4-(2-chloroethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carbaldehyde;N,3-dimethylbut-2-en-2-amine;ethane |
| SMILES | CC.CNC(C)=C(C)C.O=Cc1cnc(Nc2cc(N3CCN(CCCl)CC3)ncn2)s1 |
| InChI | InChI=1S/C14H17ClN6OS.C6H13N.C2H6/c15-1-2-20-3-5-21(6-4-20)13-7-12(17-10-18-13)19-14-16-8-11(9-22)23-14;1-5(2)6(3)7-4;1-2/h7-10H,1-6H2,(H,16,17,18,19);7H,1-4H3;1-2H3 |
| InChIKey | GRCNHUIWNUYYFY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.10 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|