About ethane;4-(4-nitrosophenyl)butanal;propan-1-amine
ethane;4-(4-nitrosophenyl)butanal;propan-1-amine (PubChem CID 178020127) has the molecular formula C17H32N2O2
and a molecular weight of 296.46 g/mol. Its IUPAC name is ethane;4-(4-nitrosophenyl)butanal;propan-1-amine.
Molecular Properties
| Compound Name | ethane;4-(4-nitrosophenyl)butanal;propan-1-amine |
| PubChem CID | 178020127 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | ethane;4-(4-nitrosophenyl)butanal;propan-1-amine |
| SMILES | CC.CC.CCCN.O=CCCCc1ccc(N=O)cc1 |
| InChI | InChI=1S/C10H11NO2.C3H9N.2C2H6/c12-8-2-1-3-9-4-6-10(11-13)7-5-9;1-2-3-4;2*1-2/h4-8H,1-3H2;2-4H2,1H3;2*1-2H3 |
| InChIKey | RWGGHZIHWQMPGT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-(4-nitrosophenyl)butanal;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(4-nitrosophenyl)butanal;propan-1-amine?
The IUPAC name of ethane;4-(4-nitrosophenyl)butanal;propan-1-amine (CID 178020127) is ethane;4-(4-nitrosophenyl)butanal;propan-1-amine.
What is the SMILES notation for ethane;4-(4-nitrosophenyl)butanal;propan-1-amine?
The canonical SMILES for ethane;4-(4-nitrosophenyl)butanal;propan-1-amine is CC.CC.CCCN.O=CCCCc1ccc(N=O)cc1.
What is the InChIKey of ethane;4-(4-nitrosophenyl)butanal;propan-1-amine?
The InChIKey is RWGGHZIHWQMPGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2.C3H9N.2C2H6/c12-8-2-1-3-9-4-6-10(11-13)7-5-9;1-2-3-4;2*1-2/h4-8H,1-3H2;2-4H2,1H3;2*1-2H3.
What are the key properties of ethane;4-(4-nitrosophenyl)butanal;propan-1-amine?
ethane;4-(4-nitrosophenyl)butanal;propan-1-amine has a molecular weight of 296.46 g/mol, XLogP of 5.01, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(4-nitrosophenyl)butanal;propan-1-amine is sourced from PubChem (CID 178020127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).