C18H21N3O2 — CID 178023575
tert-butyl N-[1-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-ynyl]cyclopropyl]carbamate (PubChem CID 178023575) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-ynyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-ynyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 178023575 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | tert-butyl N-[1-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-ynyl]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(CC#Cc2cnc3[nH]ccc3c2)CC1 |
| InChI | InChI=1S/C18H21N3O2/c1-17(2,3)23-16(22)21-18(8-9-18)7-4-5-13-11-14-6-10-19-15(14)20-12-13/h6,10-12H,7-9H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | RGKPFZUWPKSDMV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|