C11H17Cl2N3O — CID 178024402
5-[(E,4S)-4-aminopent-1-enyl]pyridine-3-carboxamide;dihydrochloride (PubChem CID 178024402) has the molecular formula C11H17Cl2N3O and a molecular weight of 278.18 g/mol. Its IUPAC name is 5-[(E,4S)-4-aminopent-1-enyl]pyridine-3-carboxamide;dihydrochloride.
| Compound Name | 5-[(E,4S)-4-aminopent-1-enyl]pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 178024402 |
| Molecular Formula | C11H17Cl2N3O |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 5-[(E,4S)-4-aminopent-1-enyl]pyridine-3-carboxamide;dihydrochloride |
| SMILES | C[C@H](N)C/C=C/c1cncc(C(N)=O)c1.Cl.Cl |
| InChI | InChI=1S/C11H15N3O.2ClH/c1-8(12)3-2-4-9-5-10(11(13)15)7-14-6-9;;/h2,4-8H,3,12H2,1H3,(H2,13,15);2*1H/b4-2+;;/t8-;;/m0../s1 |
| InChIKey | QHYKLMONAIDGJV-GGTGHYMCSA-N |
| XLogP | 1.77 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |