C26H39F2N7O3 — CID 178025782
1,1-difluoroethene;(3E)-3-[4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6-dimethylpyrimidin-4-yl]-1-(methylideneamino)-1,4-diazepan-2-ylidene]-3-hydroxy-N-methylpropanamide (PubChem CID 178025782) has the molecular formula C26H39F2N7O3 and a molecular weight of 535.64 g/mol. Its IUPAC name is 1,1-difluoroethene;(3E)-3-[4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6-dimethylpyrimidin-4-yl]-1-(methylideneamino)-1,4-diazepan-2-ylidene]-3-hydroxy-N-methylpropanamide.
| Compound Name | 1,1-difluoroethene;(3E)-3-[4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6-dimethylpyrimidin-4-yl]-1-(methylideneamino)-1,4-diazepan-2-ylidene]-3-hydroxy-N-methylpropanamide |
|---|---|
| PubChem CID | 178025782 |
| Molecular Formula | C26H39F2N7O3 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | 1,1-difluoroethene;(3E)-3-[4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6-dimethylpyrimidin-4-yl]-1-(methylideneamino)-1,4-diazepan-2-ylidene]-3-hydroxy-N-methylpropanamide |
| SMILES | C=C(F)F.C=NN1CCCN(c2nc(OCC34CCCN3CCC4)nc(C)c2C)C/C1=C(\O)CC(=O)NC |
| InChI | InChI=1S/C24H37N7O3.C2H2F2/c1-17-18(2)27-23(34-16-24-8-5-11-30(24)12-6-9-24)28-22(17)29-10-7-13-31(26-4)19(15-29)20(32)14-21(33)25-3;1-2(3)4/h32H,4-16H2,1-3H3,(H,25,33);1H2/b20-19+; |
| InChIKey | UQBOWTGNTDHNIC-RZLHGTIFSA-N |
| XLogP | 3.53 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|