C31H35F2N5OS — CID 167120080
N-[(E)-2-fluoro-1-(8-fluoronaphthalen-1-yl)-2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-yl]ethenyl]methanimine (PubChem CID 167120080) has the molecular formula C31H35F2N5OS and a molecular weight of 563.72 g/mol. Its IUPAC name is N-[(E)-2-fluoro-1-(8-fluoronaphthalen-1-yl)-2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-yl]ethenyl]methanimine.
| Compound Name | N-[(E)-2-fluoro-1-(8-fluoronaphthalen-1-yl)-2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-yl]ethenyl]methanimine |
|---|---|
| PubChem CID | 167120080 |
| Molecular Formula | C31H35F2N5OS |
| Molecular Weight | 563.72 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | N-[(E)-2-fluoro-1-(8-fluoronaphthalen-1-yl)-2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-methyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-yl]ethenyl]methanimine |
| SMILES | C=N/C(=C(/F)c1nc(OCC23CCCN2CCC3)nc(N2CCCSCC2)c1C)c1cccc2cccc(F)c12 |
| InChI | InChI=1S/C31H35F2N5OS/c1-21-27(26(33)28(34-2)23-10-3-8-22-9-4-11-24(32)25(22)23)35-30(36-29(21)37-14-7-18-40-19-17-37)39-20-31-12-5-15-38(31)16-6-13-31/h3-4,8-11H,2,5-7,12-20H2,1H3/b28-26+ |
| InChIKey | HGVPUDZWNYLQSW-BYCLXTJYSA-N |
| XLogP | 6.52 |
| TPSA | 53.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.72 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|