C26H32ClF3N4S — CID 178026333
N-[3-chloro-4-[3-[[1-(3,3-dimethylpyrrolidin-1-yl)cyclobutyl]methyl]-3-methylazetidin-1-yl]-2,6-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine (PubChem CID 178026333) has the molecular formula C26H32ClF3N4S and a molecular weight of 525.08 g/mol. Its IUPAC name is N-[3-chloro-4-[3-[[1-(3,3-dimethylpyrrolidin-1-yl)cyclobutyl]methyl]-3-methylazetidin-1-yl]-2,6-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine.
| Compound Name | N-[3-chloro-4-[3-[[1-(3,3-dimethylpyrrolidin-1-yl)cyclobutyl]methyl]-3-methylazetidin-1-yl]-2,6-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 178026333 |
| Molecular Formula | C26H32ClF3N4S |
| Molecular Weight | 525.08 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | N-[3-chloro-4-[3-[[1-(3,3-dimethylpyrrolidin-1-yl)cyclobutyl]methyl]-3-methylazetidin-1-yl]-2,6-difluorophenyl]sulfanyl-6-fluoropyridin-2-amine |
| SMILES | CC1(C)CCN(C2(CC3(C)CN(c4cc(F)c(SNc5cccc(F)n5)c(F)c4Cl)C3)CCC2)C1 |
| InChI | InChI=1S/C26H32ClF3N4S/c1-24(2)10-11-34(14-24)26(8-5-9-26)13-25(3)15-33(16-25)18-12-17(28)23(22(30)21(18)27)35-32-20-7-4-6-19(29)31-20/h4,6-7,12H,5,8-11,13-16H2,1-3H3,(H,31,32) |
| InChIKey | BTCKRIYWONBSMV-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.08 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|