C17H14F3N3O3 — CID 178027659
1-[3-[C-(1,3-oxazol-2-yl)-N-[4-(trifluoromethyl)phenoxy]carbonimidoyl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 178027659) has the molecular formula C17H14F3N3O3 and a molecular weight of 365.31 g/mol. Its IUPAC name is 1-[3-[C-(1,3-oxazol-2-yl)-N-[4-(trifluoromethyl)phenoxy]carbonimidoyl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[C-(1,3-oxazol-2-yl)-N-[4-(trifluoromethyl)phenoxy]carbonimidoyl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 178027659 |
| Molecular Formula | C17H14F3N3O3 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-[3-[C-(1,3-oxazol-2-yl)-N-[4-(trifluoromethyl)phenoxy]carbonimidoyl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(C(=NOc2ccc(C(F)(F)F)cc2)c2ncco2)C1 |
| InChI | InChI=1S/C17H14F3N3O3/c1-2-14(24)23-9-11(10-23)15(16-21-7-8-25-16)22-26-13-5-3-12(4-6-13)17(18,19)20/h2-8,11H,1,9-10H2 |
| InChIKey | RKCDTLWGLIYURO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|