C26H30O8S2 — CID 178028126
2-[1-[2-(2-methylsulfinyloxyethoxy)naphthalen-1-yl]naphthalen-2-yl]oxyethyl methanesulfinate;dihydrate (PubChem CID 178028126) has the molecular formula C26H30O8S2 and a molecular weight of 534.65 g/mol. Its IUPAC name is 2-[1-[2-(2-methylsulfinyloxyethoxy)naphthalen-1-yl]naphthalen-2-yl]oxyethyl methanesulfinate;dihydrate.
| Compound Name | 2-[1-[2-(2-methylsulfinyloxyethoxy)naphthalen-1-yl]naphthalen-2-yl]oxyethyl methanesulfinate;dihydrate |
|---|---|
| PubChem CID | 178028126 |
| Molecular Formula | C26H30O8S2 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 2-[1-[2-(2-methylsulfinyloxyethoxy)naphthalen-1-yl]naphthalen-2-yl]oxyethyl methanesulfinate;dihydrate |
| SMILES | CS(=O)OCCOc1ccc2ccccc2c1-c1c(OCCOS(C)=O)ccc2ccccc12.O.O |
| InChI | InChI=1S/C26H26O6S2.2H2O/c1-33(27)31-17-15-29-23-13-11-19-7-3-5-9-21(19)25(23)26-22-10-6-4-8-20(22)12-14-24(26)30-16-18-32-34(2)28;;/h3-14H,15-18H2,1-2H3;2*1H2 |
| InChIKey | AYNLAWSRPRLHED-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 134.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|