C7H8N2O3 — CID 178028461
4-methyl-N-(2-oxoethyl)-1,2-oxazole-3-carboxamide (PubChem CID 178028461) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is 4-methyl-N-(2-oxoethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 4-methyl-N-(2-oxoethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 178028461 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 4-methyl-N-(2-oxoethyl)-1,2-oxazole-3-carboxamide |
| SMILES | Cc1conc1C(=O)NCC=O |
| InChI | InChI=1S/C7H8N2O3/c1-5-4-12-9-6(5)7(11)8-2-3-10/h3-4H,2H2,1H3,(H,8,11) |
| InChIKey | KXASVZQVTHOJTO-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|