C34H37F2N5O5S — CID 178028744
9-[(5S)-13-(3,5-difluoro-2-pyridinyl)-20-methyl-5-methylsulfonyl-9,19-dioxo-8,13,17,20-tetrazapentacyclo[13.6.1.02,12.04,10.018,22]docosa-1(21),2,4(10),11,15,18(22)-hexaen-8-yl]nonanal (PubChem CID 178028744) has the molecular formula C34H37F2N5O5S and a molecular weight of 665.76 g/mol. Its IUPAC name is 9-[(5S)-13-(3,5-difluoro-2-pyridinyl)-20-methyl-5-methylsulfonyl-9,19-dioxo-8,13,17,20-tetrazapentacyclo[13.6.1.02,12.04,10.018,22]docosa-1(21),2,4(10),11,15,18(22)-hexaen-8-yl]nonanal.
| Compound Name | 9-[(5S)-13-(3,5-difluoro-2-pyridinyl)-20-methyl-5-methylsulfonyl-9,19-dioxo-8,13,17,20-tetrazapentacyclo[13.6.1.02,12.04,10.018,22]docosa-1(21),2,4(10),11,15,18(22)-hexaen-8-yl]nonanal |
|---|---|
| PubChem CID | 178028744 |
| Molecular Formula | C34H37F2N5O5S |
| Molecular Weight | 665.76 g/mol |
| Exact Mass | 665.25 |
| IUPAC Name | 9-[(5S)-13-(3,5-difluoro-2-pyridinyl)-20-methyl-5-methylsulfonyl-9,19-dioxo-8,13,17,20-tetrazapentacyclo[13.6.1.02,12.04,10.018,22]docosa-1(21),2,4(10),11,15,18(22)-hexaen-8-yl]nonanal |
| SMILES | Cn1cc2c3c(c[nH]c3c1=O)CN(c1ncc(F)cc1F)c1cc3c(cc1-2)[C@@H](S(C)(=O)=O)CCN(CCCCCCCCC=O)C3=O |
| InChI | InChI=1S/C34H37F2N5O5S/c1-39-20-26-23-15-24-25(33(43)40(12-10-29(24)47(2,45)46)11-8-6-4-3-5-7-9-13-42)16-28(23)41(32-27(36)14-22(35)18-38-32)19-21-17-37-31(30(21)26)34(39)44/h13-18,20,29,37H,3-12,19H2,1-2H3/t29-/m0/s1 |
| InChIKey | NDCBOGMOHUGJLJ-LJAQVGFWSA-N |
| XLogP | 5.72 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.76 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|