C25H24F2N6O3 — CID 178028822
N-(3-aminopropyl)-8-(3,5-difluoro-2-pyridinyl)-4-(hydroxymethyl)-15-methyl-14-oxo-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaene-5-carboxamide (PubChem CID 178028822) has the molecular formula C25H24F2N6O3 and a molecular weight of 494.50 g/mol. Its IUPAC name is N-(3-aminopropyl)-8-(3,5-difluoro-2-pyridinyl)-4-(hydroxymethyl)-15-methyl-14-oxo-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaene-5-carboxamide.
| Compound Name | N-(3-aminopropyl)-8-(3,5-difluoro-2-pyridinyl)-4-(hydroxymethyl)-15-methyl-14-oxo-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 178028822 |
| Molecular Formula | C25H24F2N6O3 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-(3-aminopropyl)-8-(3,5-difluoro-2-pyridinyl)-4-(hydroxymethyl)-15-methyl-14-oxo-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaene-5-carboxamide |
| SMILES | Cn1cc2c3c(c[nH]c3c1=O)CN(c1ncc(F)cc1F)c1cc(C(=O)NCCCN)c(CO)cc1-2 |
| InChI | InChI=1S/C25H24F2N6O3/c1-32-11-18-17-5-13(12-34)16(24(35)29-4-2-3-28)7-20(17)33(23-19(27)6-15(26)9-31-23)10-14-8-30-22(21(14)18)25(32)36/h5-9,11,30,34H,2-4,10,12,28H2,1H3,(H,29,35) |
| InChIKey | JTGFHKLNZUGCHI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|