C13H18N2O3S — CID 178029871
methyl (2S)-2-[(5-amino-2-hydroxybenzenecarbothioyl)amino]-3-methylbutanoate (PubChem CID 178029871) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is methyl (2S)-2-[(5-amino-2-hydroxybenzenecarbothioyl)amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[(5-amino-2-hydroxybenzenecarbothioyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 178029871 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | methyl (2S)-2-[(5-amino-2-hydroxybenzenecarbothioyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=S)c1cc(N)ccc1O)C(C)C |
| InChI | InChI=1S/C13H18N2O3S/c1-7(2)11(13(17)18-3)15-12(19)9-6-8(14)4-5-10(9)16/h4-7,11,16H,14H2,1-3H3,(H,15,19)/t11-/m0/s1 |
| InChIKey | WHTMDHBZQIANCV-NSHDSACASA-N |
| XLogP | 1.44 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|