C17H25KNO — CID 178029923
CID 178029923 (PubChem CID 178029923) has the molecular formula C17H25KNO and a molecular weight of 298.49 g/mol.
| Compound Name | CID 178029923 |
|---|---|
| PubChem CID | 178029923 |
| Molecular Formula | C17H25KNO |
| Molecular Weight | 298.49 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | — |
| SMILES | CCC(CC(C)(C)C(C)=O)c1c[nH]c2ccccc12.[H][H].[K] |
| InChI | InChI=1S/C17H23NO.K.H2/c1-5-13(10-17(3,4)12(2)19)15-11-18-16-9-7-6-8-14(15)16;;/h6-9,11,13,18H,5,10H2,1-4H3;;1H |
| InChIKey | MGXAFCFZGQNNQV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |