C13H17N4O+ — CID 178029972
[(Z)-4-amino-4-imino-1-[3-(propanoylamino)phenyl]but-2-enylidene]azanium (PubChem CID 178029972) has the molecular formula C13H17N4O+ and a molecular weight of 245.31 g/mol. Its IUPAC name is [(Z)-4-amino-4-imino-1-[3-(propanoylamino)phenyl]but-2-enylidene]azanium.
| Compound Name | [(Z)-4-amino-4-imino-1-[3-(propanoylamino)phenyl]but-2-enylidene]azanium |
|---|---|
| PubChem CID | 178029972 |
| Molecular Formula | C13H17N4O+ |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | [(Z)-4-amino-4-imino-1-[3-(propanoylamino)phenyl]but-2-enylidene]azanium |
| SMILES | [H]/N=C(N)/C=C\C(=[NH2+])c1cccc(NC(=O)CC)c1 |
| InChI | InChI=1S/C13H16N4O/c1-2-13(18)17-10-5-3-4-9(8-10)11(14)6-7-12(15)16/h3-8,14H,2H2,1H3,(H3,15,16)(H,17,18)/p+1/b7-6-,14-11? |
| InChIKey | SLXZFGXOFWDOMW-UCZZKBJDSA-O |
| XLogP | 0.08 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|