C15H13F3N4O — CID 178030288
1-[5-(6-aminopyridazin-3-yl)-2-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 178030288) has the molecular formula C15H13F3N4O and a molecular weight of 322.29 g/mol. Its IUPAC name is 1-[5-(6-aminopyridazin-3-yl)-2-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[5-(6-aminopyridazin-3-yl)-2-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 178030288 |
| Molecular Formula | C15H13F3N4O |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-[5-(6-aminopyridazin-3-yl)-2-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | NC(=O)C1(c2cc(-c3ccc(N)nn3)ccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H13F3N4O/c16-15(17,18)9-2-1-8(11-3-4-12(19)22-21-11)7-10(9)14(5-6-14)13(20)23/h1-4,7H,5-6H2,(H2,19,22)(H2,20,23) |
| InChIKey | RLPYAXYHQCSFQN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |