About 6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine
6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine (PubChem CID 178065217) has the molecular formula C12H10F3N3O
and a molecular weight of 269.23 g/mol. Its IUPAC name is 6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine.
Molecular Properties
| Compound Name | 6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine |
| PubChem CID | 178065217 |
| Molecular Formula | C12H10F3N3O |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine |
| SMILES | Nc1ccc(-c2cccc(OCC(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C12H10F3N3O/c13-12(14,15)7-19-9-3-1-2-8(6-9)10-4-5-11(16)18-17-10/h1-6H,7H2,(H2,16,18) |
| InChIKey | MVDCRAGFWNEZQS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine?
The IUPAC name of 6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine (CID 178065217) is 6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine.
What is the SMILES notation for 6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine?
The canonical SMILES for 6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine is Nc1ccc(-c2cccc(OCC(F)(F)F)c2)nn1.
What is the InChIKey of 6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine?
The InChIKey is MVDCRAGFWNEZQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3N3O/c13-12(14,15)7-19-9-3-1-2-8(6-9)10-4-5-11(16)18-17-10/h1-6H,7H2,(H2,16,18).
What are the key properties of 6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine?
6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine has a molecular weight of 269.23 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(2,2,2-trifluoroethoxy)phenyl]pyridazin-3-amine is sourced from PubChem (CID 178065217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).